C12H25N3S — CID 82917200
N-methyl-1-(1-methylpyrrolidin-3-yl)-N-(thiomorpholin-3-ylmethyl)methanamine (PubChem CID 82917200) has the molecular formula C12H25N3S and a molecular weight of 243.42 g/mol. Its IUPAC name is N-methyl-1-(1-methylpyrrolidin-3-yl)-N-(thiomorpholin-3-ylmethyl)methanamine.
| Compound Name | N-methyl-1-(1-methylpyrrolidin-3-yl)-N-(thiomorpholin-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 82917200 |
| Molecular Formula | C12H25N3S |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | N-methyl-1-(1-methylpyrrolidin-3-yl)-N-(thiomorpholin-3-ylmethyl)methanamine |
| SMILES | CN1CCC(CN(C)CC2CSCCN2)C1 |
| InChI | InChI=1S/C12H25N3S/c1-14-5-3-11(7-14)8-15(2)9-12-10-16-6-4-13-12/h11-13H,3-10H2,1-2H3 |
| InChIKey | HFRNBRCINIBIDC-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |