C13H19N3OS — CID 82918088
N-ethyl-N-(pyridin-2-ylmethyl)thiomorpholine-3-carboxamide (PubChem CID 82918088) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is N-ethyl-N-(pyridin-2-ylmethyl)thiomorpholine-3-carboxamide.
| Compound Name | N-ethyl-N-(pyridin-2-ylmethyl)thiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 82918088 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | N-ethyl-N-(pyridin-2-ylmethyl)thiomorpholine-3-carboxamide |
| SMILES | CCN(Cc1ccccn1)C(=O)C1CSCCN1 |
| InChI | InChI=1S/C13H19N3OS/c1-2-16(9-11-5-3-4-6-14-11)13(17)12-10-18-8-7-15-12/h3-6,12,15H,2,7-10H2,1H3 |
| InChIKey | BNCCCTBPDBBVTK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |