C14H20F2N4O — CID 82918142
2-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]-N'-hydroxypropanimidamide (PubChem CID 82918142) has the molecular formula C14H20F2N4O and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]-N'-hydroxypropanimidamide.
| Compound Name | 2-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 82918142 |
| Molecular Formula | C14H20F2N4O |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-[4-[(3,4-difluorophenyl)methyl]piperazin-1-yl]-N'-hydroxypropanimidamide |
| SMILES | CC(/C(N)=N/O)N1CCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C14H20F2N4O/c1-10(14(17)18-21)20-6-4-19(5-7-20)9-11-2-3-12(15)13(16)8-11/h2-3,8,10,21H,4-7,9H2,1H3,(H2,17,18) |
| InChIKey | QECWZBNSAFQHSG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|