C19H33FN2 — CID 145147233
ethane;1-[(3-fluoro-4-propan-2-ylphenyl)methyl]-4-propan-2-ylpiperazine (PubChem CID 145147233) has the molecular formula C19H33FN2 and a molecular weight of 308.49 g/mol. Its IUPAC name is ethane;1-[(3-fluoro-4-propan-2-ylphenyl)methyl]-4-propan-2-ylpiperazine.
| Compound Name | ethane;1-[(3-fluoro-4-propan-2-ylphenyl)methyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 145147233 |
| Molecular Formula | C19H33FN2 |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | ethane;1-[(3-fluoro-4-propan-2-ylphenyl)methyl]-4-propan-2-ylpiperazine |
| SMILES | CC.CC(C)c1ccc(CN2CCN(C(C)C)CC2)cc1F |
| InChI | InChI=1S/C17H27FN2.C2H6/c1-13(2)16-6-5-15(11-17(16)18)12-19-7-9-20(10-8-19)14(3)4;1-2/h5-6,11,13-14H,7-10,12H2,1-4H3;1-2H3 |
| InChIKey | LIZJBNVQGKYMEM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |