C14H13F2NO — CID 82918739
2-[(3,4-difluorophenyl)methoxy]-4-methylaniline (PubChem CID 82918739) has the molecular formula C14H13F2NO and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methoxy]-4-methylaniline.
| Compound Name | 2-[(3,4-difluorophenyl)methoxy]-4-methylaniline |
|---|---|
| PubChem CID | 82918739 |
| Molecular Formula | C14H13F2NO |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methoxy]-4-methylaniline |
| SMILES | Cc1ccc(N)c(OCc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C14H13F2NO/c1-9-2-5-13(17)14(6-9)18-8-10-3-4-11(15)12(16)7-10/h2-7H,8,17H2,1H3 |
| InChIKey | WNTSIWGICLGUSS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|