C12H15N3O3S — CID 82921804
3-methyl-4-[(3-methylimidazol-4-yl)methoxy]benzenesulfonamide (PubChem CID 82921804) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-methyl-4-[(3-methylimidazol-4-yl)methoxy]benzenesulfonamide.
| Compound Name | 3-methyl-4-[(3-methylimidazol-4-yl)methoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 82921804 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-methyl-4-[(3-methylimidazol-4-yl)methoxy]benzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)ccc1OCc1cncn1C |
| InChI | InChI=1S/C12H15N3O3S/c1-9-5-11(19(13,16)17)3-4-12(9)18-7-10-6-14-8-15(10)2/h3-6,8H,7H2,1-2H3,(H2,13,16,17) |
| InChIKey | SQKMIGDMPLDPDT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |