C10H11Cl2NO4S — CID 82922031
2-(1-amino-1-oxobutan-2-yl)oxy-5-chlorobenzenesulfonyl chloride (PubChem CID 82922031) has the molecular formula C10H11Cl2NO4S and a molecular weight of 312.17 g/mol. Its IUPAC name is 2-(1-amino-1-oxobutan-2-yl)oxy-5-chlorobenzenesulfonyl chloride.
| Compound Name | 2-(1-amino-1-oxobutan-2-yl)oxy-5-chlorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82922031 |
| Molecular Formula | C10H11Cl2NO4S |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 2-(1-amino-1-oxobutan-2-yl)oxy-5-chlorobenzenesulfonyl chloride |
| SMILES | CCC(Oc1ccc(Cl)cc1S(=O)(=O)Cl)C(N)=O |
| InChI | InChI=1S/C10H11Cl2NO4S/c1-2-7(10(13)14)17-8-4-3-6(11)5-9(8)18(12,15)16/h3-5,7H,2H2,1H3,(H2,13,14) |
| InChIKey | YTLKXVCJTQOKOE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |