C16H26FNS — CID 82923437
N,4-diethyl-1-(3-fluorophenyl)sulfanylhexan-2-amine (PubChem CID 82923437) has the molecular formula C16H26FNS and a molecular weight of 283.46 g/mol. Its IUPAC name is N,4-diethyl-1-(3-fluorophenyl)sulfanylhexan-2-amine.
| Compound Name | N,4-diethyl-1-(3-fluorophenyl)sulfanylhexan-2-amine |
|---|---|
| PubChem CID | 82923437 |
| Molecular Formula | C16H26FNS |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N,4-diethyl-1-(3-fluorophenyl)sulfanylhexan-2-amine |
| SMILES | CCNC(CSc1cccc(F)c1)CC(CC)CC |
| InChI | InChI=1S/C16H26FNS/c1-4-13(5-2)10-15(18-6-3)12-19-16-9-7-8-14(17)11-16/h7-9,11,13,15,18H,4-6,10,12H2,1-3H3 |
| InChIKey | IEBGUHPTLFIRCY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |