C15H18FNOS — CID 83175253
N-ethyl-1-(3-fluorophenyl)sulfanyl-3-(furan-3-yl)propan-2-amine (PubChem CID 83175253) has the molecular formula C15H18FNOS and a molecular weight of 279.38 g/mol. Its IUPAC name is N-ethyl-1-(3-fluorophenyl)sulfanyl-3-(furan-3-yl)propan-2-amine.
| Compound Name | N-ethyl-1-(3-fluorophenyl)sulfanyl-3-(furan-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 83175253 |
| Molecular Formula | C15H18FNOS |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-ethyl-1-(3-fluorophenyl)sulfanyl-3-(furan-3-yl)propan-2-amine |
| SMILES | CCNC(CSc1cccc(F)c1)Cc1ccoc1 |
| InChI | InChI=1S/C15H18FNOS/c1-2-17-14(8-12-6-7-18-10-12)11-19-15-5-3-4-13(16)9-15/h3-7,9-10,14,17H,2,8,11H2,1H3 |
| InChIKey | CCPJUSWUQXFRDM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |