About N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine
N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine (PubChem CID 82941710) has the molecular formula C17H31N3O
and a molecular weight of 293.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine |
| PubChem CID | 82941710 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine |
| SMILES | CCCNCc1c(C)cc(C)nc1N(CCOC)C(C)C |
| InChI | InChI=1S/C17H31N3O/c1-7-8-18-12-16-14(4)11-15(5)19-17(16)20(13(2)3)9-10-21-6/h11,13,18H,7-10,12H2,1-6H3 |
| InChIKey | QMZRKFKJZIBSKX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine?
The IUPAC name of N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine (CID 82941710) is N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine.
What is the SMILES notation for N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine?
The canonical SMILES for N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine is CCCNCc1c(C)cc(C)nc1N(CCOC)C(C)C.
What is the InChIKey of N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine?
The InChIKey is QMZRKFKJZIBSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31N3O/c1-7-8-18-12-16-14(4)11-15(5)19-17(16)20(13(2)3)9-10-21-6/h11,13,18H,7-10,12H2,1-6H3.
What are the key properties of N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine?
N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine has a molecular weight of 293.45 g/mol, XLogP of 3.06, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-4,6-dimethyl-N-propan-2-yl-3-(propylaminomethyl)pyridin-2-amine is sourced from PubChem (CID 82941710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).