C17H25N3S — CID 62279602
N,4,6-trimethyl-3-(propylaminomethyl)-N-(thiophen-3-ylmethyl)pyridin-2-amine (PubChem CID 62279602) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is N,4,6-trimethyl-3-(propylaminomethyl)-N-(thiophen-3-ylmethyl)pyridin-2-amine.
| Compound Name | N,4,6-trimethyl-3-(propylaminomethyl)-N-(thiophen-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62279602 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N,4,6-trimethyl-3-(propylaminomethyl)-N-(thiophen-3-ylmethyl)pyridin-2-amine |
| SMILES | CCCNCc1c(C)cc(C)nc1N(C)Cc1ccsc1 |
| InChI | InChI=1S/C17H25N3S/c1-5-7-18-10-16-13(2)9-14(3)19-17(16)20(4)11-15-6-8-21-12-15/h6,8-9,12,18H,5,7,10-11H2,1-4H3 |
| InChIKey | OTOKHINQGKORIT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|