C16H19ClN2 — CID 61255946
N-benzyl-3-(chloromethyl)-N,4,6-trimethylpyridin-2-amine (PubChem CID 61255946) has the molecular formula C16H19ClN2 and a molecular weight of 274.79 g/mol. Its IUPAC name is N-benzyl-3-(chloromethyl)-N,4,6-trimethylpyridin-2-amine.
| Compound Name | N-benzyl-3-(chloromethyl)-N,4,6-trimethylpyridin-2-amine |
|---|---|
| PubChem CID | 61255946 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | N-benzyl-3-(chloromethyl)-N,4,6-trimethylpyridin-2-amine |
| SMILES | Cc1cc(C)c(CCl)c(N(C)Cc2ccccc2)n1 |
| InChI | InChI=1S/C16H19ClN2/c1-12-9-13(2)18-16(15(12)10-17)19(3)11-14-7-5-4-6-8-14/h4-9H,10-11H2,1-3H3 |
| InChIKey | FTQXDUQJJMQDSF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|