C15H28N4O — CID 82946495
6-N,5-dimethyl-2-propan-2-yl-4-N-(3-propoxypropyl)pyrimidine-4,6-diamine (PubChem CID 82946495) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 6-N,5-dimethyl-2-propan-2-yl-4-N-(3-propoxypropyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N,5-dimethyl-2-propan-2-yl-4-N-(3-propoxypropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 82946495 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 6-N,5-dimethyl-2-propan-2-yl-4-N-(3-propoxypropyl)pyrimidine-4,6-diamine |
| SMILES | CCCOCCCNc1nc(C(C)C)nc(NC)c1C |
| InChI | InChI=1S/C15H28N4O/c1-6-9-20-10-7-8-17-15-12(4)14(16-5)18-13(19-15)11(2)3/h11H,6-10H2,1-5H3,(H2,16,17,18,19) |
| InChIKey | PXELUFQPFSBMEG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|