C15H33N3O — CID 82948086
4-(aminomethyl)-1-ethyl-N-(2-methoxyethyl)-N-propan-2-ylazepan-4-amine (PubChem CID 82948086) has the molecular formula C15H33N3O and a molecular weight of 271.45 g/mol. Its IUPAC name is 4-(aminomethyl)-1-ethyl-N-(2-methoxyethyl)-N-propan-2-ylazepan-4-amine.
| Compound Name | 4-(aminomethyl)-1-ethyl-N-(2-methoxyethyl)-N-propan-2-ylazepan-4-amine |
|---|---|
| PubChem CID | 82948086 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | 4-(aminomethyl)-1-ethyl-N-(2-methoxyethyl)-N-propan-2-ylazepan-4-amine |
| SMILES | CCN1CCCC(CN)(N(CCOC)C(C)C)CC1 |
| InChI | InChI=1S/C15H33N3O/c1-5-17-9-6-7-15(13-16,8-10-17)18(14(2)3)11-12-19-4/h14H,5-13,16H2,1-4H3 |
| InChIKey | QJKSQFXMOYWXSP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |