C17H37N3 — CID 79483196
4-(aminomethyl)-1-ethyl-N-(2-methylpropyl)-N-pentan-3-ylpiperidin-4-amine (PubChem CID 79483196) has the molecular formula C17H37N3 and a molecular weight of 283.50 g/mol. Its IUPAC name is 4-(aminomethyl)-1-ethyl-N-(2-methylpropyl)-N-pentan-3-ylpiperidin-4-amine.
| Compound Name | 4-(aminomethyl)-1-ethyl-N-(2-methylpropyl)-N-pentan-3-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 79483196 |
| Molecular Formula | C17H37N3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.30 |
| IUPAC Name | 4-(aminomethyl)-1-ethyl-N-(2-methylpropyl)-N-pentan-3-ylpiperidin-4-amine |
| SMILES | CCC(CC)N(CC(C)C)C1(CN)CCN(CC)CC1 |
| InChI | InChI=1S/C17H37N3/c1-6-16(7-2)20(13-15(4)5)17(14-18)9-11-19(8-3)12-10-17/h15-16H,6-14,18H2,1-5H3 |
| InChIKey | FIOXWNCANFJBAT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |