C22H39N3 — CID 112742877
3-(aminomethyl)-1-benzyl-5-methyl-N-(2-methylpropyl)-N-pentan-3-ylpyrrolidin-3-amine (PubChem CID 112742877) has the molecular formula C22H39N3 and a molecular weight of 345.57 g/mol. Its IUPAC name is 3-(aminomethyl)-1-benzyl-5-methyl-N-(2-methylpropyl)-N-pentan-3-ylpyrrolidin-3-amine.
| Compound Name | 3-(aminomethyl)-1-benzyl-5-methyl-N-(2-methylpropyl)-N-pentan-3-ylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 112742877 |
| Molecular Formula | C22H39N3 |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.31 |
| IUPAC Name | 3-(aminomethyl)-1-benzyl-5-methyl-N-(2-methylpropyl)-N-pentan-3-ylpyrrolidin-3-amine |
| SMILES | CCC(CC)N(CC(C)C)C1(CN)CC(C)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H39N3/c1-6-21(7-2)25(14-18(3)4)22(16-23)13-19(5)24(17-22)15-20-11-9-8-10-12-20/h8-12,18-19,21H,6-7,13-17,23H2,1-5H3 |
| InChIKey | YZDVPYWIXMVTPQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |