C21H34N4 — CID 112742858
[1-benzyl-3-[4-(cyclopropylmethyl)piperazin-1-yl]-5-methylpyrrolidin-3-yl]methanamine (PubChem CID 112742858) has the molecular formula C21H34N4 and a molecular weight of 342.53 g/mol. Its IUPAC name is [1-benzyl-3-[4-(cyclopropylmethyl)piperazin-1-yl]-5-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-benzyl-3-[4-(cyclopropylmethyl)piperazin-1-yl]-5-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 112742858 |
| Molecular Formula | C21H34N4 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | [1-benzyl-3-[4-(cyclopropylmethyl)piperazin-1-yl]-5-methylpyrrolidin-3-yl]methanamine |
| SMILES | CC1CC(CN)(N2CCN(CC3CC3)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C21H34N4/c1-18-13-21(16-22,17-24(18)15-19-5-3-2-4-6-19)25-11-9-23(10-12-25)14-20-7-8-20/h2-6,18,20H,7-17,22H2,1H3 |
| InChIKey | JGRNSCZWMKRBJE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |