C15H9N3O2S — CID 829492
2-(furan-2-yl)-3-(1,3-thiazol-2-yl)quinazolin-4-one (PubChem CID 829492) has the molecular formula C15H9N3O2S and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-(furan-2-yl)-3-(1,3-thiazol-2-yl)quinazolin-4-one.
| Compound Name | 2-(furan-2-yl)-3-(1,3-thiazol-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 829492 |
| Molecular Formula | C15H9N3O2S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-(furan-2-yl)-3-(1,3-thiazol-2-yl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2ccco2)n1-c1nccs1 |
| InChI | InChI=1S/C15H9N3O2S/c19-14-10-4-1-2-5-11(10)17-13(12-6-3-8-20-12)18(14)15-16-7-9-21-15/h1-9H |
| InChIKey | JBAVBCTVCLTRNT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |