C17H13N5O3 — CID 829528
3-(1,3-benzodioxol-5-yl)-N-(pyridin-3-ylmethylideneamino)-1H-pyrazole-5-carboxamide (PubChem CID 829528) has the molecular formula C17H13N5O3 and a molecular weight of 335.32 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(pyridin-3-ylmethylideneamino)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(pyridin-3-ylmethylideneamino)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 829528 |
| Molecular Formula | C17H13N5O3 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(pyridin-3-ylmethylideneamino)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NN=Cc1cccnc1)c1cc(-c2ccc3c(c2)OCO3)n[nH]1 |
| InChI | InChI=1S/C17H13N5O3/c23-17(22-19-9-11-2-1-5-18-8-11)14-7-13(20-21-14)12-3-4-15-16(6-12)25-10-24-15/h1-9H,10H2,(H,20,21)(H,22,23) |
| InChIKey | JSDDIFGGASGVBC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|