C13H23ClN4O2 — CID 82952991
5-chloro-4-N,4-N-bis(2-ethoxyethyl)-2-N-methylpyrimidine-2,4-diamine (PubChem CID 82952991) has the molecular formula C13H23ClN4O2 and a molecular weight of 302.81 g/mol. Its IUPAC name is 5-chloro-4-N,4-N-bis(2-ethoxyethyl)-2-N-methylpyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N,4-N-bis(2-ethoxyethyl)-2-N-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 82952991 |
| Molecular Formula | C13H23ClN4O2 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 5-chloro-4-N,4-N-bis(2-ethoxyethyl)-2-N-methylpyrimidine-2,4-diamine |
| SMILES | CCOCCN(CCOCC)c1nc(NC)ncc1Cl |
| InChI | InChI=1S/C13H23ClN4O2/c1-4-19-8-6-18(7-9-20-5-2)12-11(14)10-16-13(15-3)17-12/h10H,4-9H2,1-3H3,(H,15,16,17) |
| InChIKey | VRRPLAVLCUVNJU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|