C13H15F3O2 — CID 82954338
1-(4-methylphenyl)-2-(3,3,3-trifluoropropoxy)propan-1-one (PubChem CID 82954338) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-(3,3,3-trifluoropropoxy)propan-1-one.
| Compound Name | 1-(4-methylphenyl)-2-(3,3,3-trifluoropropoxy)propan-1-one |
|---|---|
| PubChem CID | 82954338 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-(4-methylphenyl)-2-(3,3,3-trifluoropropoxy)propan-1-one |
| SMILES | Cc1ccc(C(=O)C(C)OCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O2/c1-9-3-5-11(6-4-9)12(17)10(2)18-8-7-13(14,15)16/h3-6,10H,7-8H2,1-2H3 |
| InChIKey | RAJMFBFVYPWNEW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |