C13H14ClF3O2 — CID 82787950
1-(3-chlorophenyl)-2-(4,4,4-trifluorobutoxy)propan-1-one (PubChem CID 82787950) has the molecular formula C13H14ClF3O2 and a molecular weight of 294.70 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(4,4,4-trifluorobutoxy)propan-1-one.
| Compound Name | 1-(3-chlorophenyl)-2-(4,4,4-trifluorobutoxy)propan-1-one |
|---|---|
| PubChem CID | 82787950 |
| Molecular Formula | C13H14ClF3O2 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(4,4,4-trifluorobutoxy)propan-1-one |
| SMILES | CC(OCCCC(F)(F)F)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H14ClF3O2/c1-9(19-7-3-6-13(15,16)17)12(18)10-4-2-5-11(14)8-10/h2,4-5,8-9H,3,6-7H2,1H3 |
| InChIKey | SAOSGQRTHQWJSQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|