C15H12Cl2O3S — CID 82956938
methyl 2-[(3,4-dichlorophenyl)sulfinylmethyl]benzoate (PubChem CID 82956938) has the molecular formula C15H12Cl2O3S and a molecular weight of 343.23 g/mol. Its IUPAC name is methyl 2-[(3,4-dichlorophenyl)sulfinylmethyl]benzoate.
| Compound Name | methyl 2-[(3,4-dichlorophenyl)sulfinylmethyl]benzoate |
|---|---|
| PubChem CID | 82956938 |
| Molecular Formula | C15H12Cl2O3S |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | methyl 2-[(3,4-dichlorophenyl)sulfinylmethyl]benzoate |
| SMILES | COC(=O)c1ccccc1CS(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2O3S/c1-20-15(18)12-5-3-2-4-10(12)9-21(19)11-6-7-13(16)14(17)8-11/h2-8H,9H2,1H3 |
| InChIKey | DQCALZMLSQXZGT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |