C18H20BrNO — CID 82957088
1-[4-bromo-2-(3-phenylpyrrolidin-1-yl)phenyl]ethanol (PubChem CID 82957088) has the molecular formula C18H20BrNO and a molecular weight of 346.27 g/mol. Its IUPAC name is 1-[4-bromo-2-(3-phenylpyrrolidin-1-yl)phenyl]ethanol.
| Compound Name | 1-[4-bromo-2-(3-phenylpyrrolidin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 82957088 |
| Molecular Formula | C18H20BrNO |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 1-[4-bromo-2-(3-phenylpyrrolidin-1-yl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(Br)cc1N1CCC(c2ccccc2)C1 |
| InChI | InChI=1S/C18H20BrNO/c1-13(21)17-8-7-16(19)11-18(17)20-10-9-15(12-20)14-5-3-2-4-6-14/h2-8,11,13,15,21H,9-10,12H2,1H3 |
| InChIKey | YEVNFNSLYFXPNK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |