C13H15BrN2O2 — CID 82971166
4-[5-bromo-2-(1-hydroxyethyl)phenyl]morpholine-2-carbonitrile (PubChem CID 82971166) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 4-[5-bromo-2-(1-hydroxyethyl)phenyl]morpholine-2-carbonitrile.
| Compound Name | 4-[5-bromo-2-(1-hydroxyethyl)phenyl]morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 82971166 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 4-[5-bromo-2-(1-hydroxyethyl)phenyl]morpholine-2-carbonitrile |
| SMILES | CC(O)c1ccc(Br)cc1N1CCOC(C#N)C1 |
| InChI | InChI=1S/C13H15BrN2O2/c1-9(17)12-3-2-10(14)6-13(12)16-4-5-18-11(7-15)8-16/h2-3,6,9,11,17H,4-5,8H2,1H3 |
| InChIKey | GXCDSCNNVAXVDL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |