C13H16BrN3O — CID 82968886
4-[2-(1-aminoethyl)-4-bromophenyl]morpholine-2-carbonitrile (PubChem CID 82968886) has the molecular formula C13H16BrN3O and a molecular weight of 310.20 g/mol. Its IUPAC name is 4-[2-(1-aminoethyl)-4-bromophenyl]morpholine-2-carbonitrile.
| Compound Name | 4-[2-(1-aminoethyl)-4-bromophenyl]morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 82968886 |
| Molecular Formula | C13H16BrN3O |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 4-[2-(1-aminoethyl)-4-bromophenyl]morpholine-2-carbonitrile |
| SMILES | CC(N)c1cc(Br)ccc1N1CCOC(C#N)C1 |
| InChI | InChI=1S/C13H16BrN3O/c1-9(16)12-6-10(14)2-3-13(12)17-4-5-18-11(7-15)8-17/h2-3,6,9,11H,4-5,8,16H2,1H3 |
| InChIKey | HBPDRBLRIMMDEB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |