C12H22N4O3S — CID 82959675
N,N-bis(2-ethoxyethyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 82959675) has the molecular formula C12H22N4O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is N,N-bis(2-ethoxyethyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N,N-bis(2-ethoxyethyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 82959675 |
| Molecular Formula | C12H22N4O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N,N-bis(2-ethoxyethyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCOCCN(CCOCC)C(=O)c1nnc(NC)s1 |
| InChI | InChI=1S/C12H22N4O3S/c1-4-18-8-6-16(7-9-19-5-2)11(17)10-14-15-12(13-3)20-10/h4-9H2,1-3H3,(H,13,15) |
| InChIKey | BFTZIOVWGNVNCB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|