C7H12N4O2S — CID 80615073
N-(2-methoxyethyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80615073) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is N-(2-methoxyethyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80615073 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | N-(2-methoxyethyl)-5-(methylamino)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CNc1nnc(C(=O)NCCOC)s1 |
| InChI | InChI=1S/C7H12N4O2S/c1-8-7-11-10-6(14-7)5(12)9-3-4-13-2/h3-4H2,1-2H3,(H,8,11)(H,9,12) |
| InChIKey | OQANKAHIKURJJF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|