C11H20N4O2S — CID 80617528
N-(2-butoxyethyl)-5-(ethylamino)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80617528) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is N-(2-butoxyethyl)-5-(ethylamino)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-(2-butoxyethyl)-5-(ethylamino)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80617528 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(2-butoxyethyl)-5-(ethylamino)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCCOCCNC(=O)c1nnc(NCC)s1 |
| InChI | InChI=1S/C11H20N4O2S/c1-3-5-7-17-8-6-13-9(16)10-14-15-11(18-10)12-4-2/h3-8H2,1-2H3,(H,12,15)(H,13,16) |
| InChIKey | RHPQZKHNPWTKFQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|