C10H15F3N4OS — CID 115522177
5-(ethylamino)-N-(5,5,5-trifluoropentyl)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 115522177) has the molecular formula C10H15F3N4OS and a molecular weight of 296.32 g/mol. Its IUPAC name is 5-(ethylamino)-N-(5,5,5-trifluoropentyl)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-(ethylamino)-N-(5,5,5-trifluoropentyl)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 115522177 |
| Molecular Formula | C10H15F3N4OS |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-(ethylamino)-N-(5,5,5-trifluoropentyl)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCNc1nnc(C(=O)NCCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C10H15F3N4OS/c1-2-14-9-17-16-8(19-9)7(18)15-6-4-3-5-10(11,12)13/h2-6H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | FMAYCZMAHGJKKH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|