C8H15N5O3S2 — CID 80616080
5-(ethylamino)-N-[2-(methanesulfonamido)ethyl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 80616080) has the molecular formula C8H15N5O3S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 5-(ethylamino)-N-[2-(methanesulfonamido)ethyl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-(ethylamino)-N-[2-(methanesulfonamido)ethyl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 80616080 |
| Molecular Formula | C8H15N5O3S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 5-(ethylamino)-N-[2-(methanesulfonamido)ethyl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCNc1nnc(C(=O)NCCNS(C)(=O)=O)s1 |
| InChI | InChI=1S/C8H15N5O3S2/c1-3-9-8-13-12-7(17-8)6(14)10-4-5-11-18(2,15)16/h11H,3-5H2,1-2H3,(H,9,13)(H,10,14) |
| InChIKey | WESSBQFAEQLBFN-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|