C10H19N5O3S2 — CID 106342390
N-[3-(methanesulfonamido)propyl]-5-(propylamino)-1,3,4-thiadiazole-2-carboxamide (PubChem CID 106342390) has the molecular formula C10H19N5O3S2 and a molecular weight of 321.43 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)propyl]-5-(propylamino)-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-[3-(methanesulfonamido)propyl]-5-(propylamino)-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 106342390 |
| Molecular Formula | C10H19N5O3S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | N-[3-(methanesulfonamido)propyl]-5-(propylamino)-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCNc1nnc(C(=O)NCCCNS(C)(=O)=O)s1 |
| InChI | InChI=1S/C10H19N5O3S2/c1-3-5-12-10-15-14-9(19-10)8(16)11-6-4-7-13-20(2,17)18/h13H,3-7H2,1-2H3,(H,11,16)(H,12,15) |
| InChIKey | INPFPBRWBQMGKZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|