C7H11N5O3S — CID 83215592
2-[[5-(methylamino)-1,3,4-thiadiazole-2-carbonyl]amino]ethyl carbamate (PubChem CID 83215592) has the molecular formula C7H11N5O3S and a molecular weight of 245.26 g/mol. Its IUPAC name is 2-[[5-(methylamino)-1,3,4-thiadiazole-2-carbonyl]amino]ethyl carbamate.
| Compound Name | 2-[[5-(methylamino)-1,3,4-thiadiazole-2-carbonyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83215592 |
| Molecular Formula | C7H11N5O3S |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[[5-(methylamino)-1,3,4-thiadiazole-2-carbonyl]amino]ethyl carbamate |
| SMILES | CNc1nnc(C(=O)NCCOC(N)=O)s1 |
| InChI | InChI=1S/C7H11N5O3S/c1-9-7-12-11-5(16-7)4(13)10-2-3-15-6(8)14/h2-3H2,1H3,(H2,8,14)(H,9,12)(H,10,13) |
| InChIKey | ABYNIWHNWGGOGQ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|