C15H30N4O2 — CID 82959710
5-N,5-N-bis(2-ethoxyethyl)-3-methyl-1-propan-2-ylpyrazole-4,5-diamine (PubChem CID 82959710) has the molecular formula C15H30N4O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 5-N,5-N-bis(2-ethoxyethyl)-3-methyl-1-propan-2-ylpyrazole-4,5-diamine.
| Compound Name | 5-N,5-N-bis(2-ethoxyethyl)-3-methyl-1-propan-2-ylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 82959710 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 5-N,5-N-bis(2-ethoxyethyl)-3-methyl-1-propan-2-ylpyrazole-4,5-diamine |
| SMILES | CCOCCN(CCOCC)c1c(N)c(C)nn1C(C)C |
| InChI | InChI=1S/C15H30N4O2/c1-6-20-10-8-18(9-11-21-7-2)15-14(16)13(5)17-19(15)12(3)4/h12H,6-11,16H2,1-5H3 |
| InChIKey | IAFIWLASRPMNPA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|