C11H22N4O — CID 104551173
2-[(4-amino-3-methyl-1-propan-2-ylpyrazol-5-yl)-methylamino]propan-1-ol (PubChem CID 104551173) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[(4-amino-3-methyl-1-propan-2-ylpyrazol-5-yl)-methylamino]propan-1-ol.
| Compound Name | 2-[(4-amino-3-methyl-1-propan-2-ylpyrazol-5-yl)-methylamino]propan-1-ol |
|---|---|
| PubChem CID | 104551173 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 2-[(4-amino-3-methyl-1-propan-2-ylpyrazol-5-yl)-methylamino]propan-1-ol |
| SMILES | Cc1nn(C(C)C)c(N(C)C(C)CO)c1N |
| InChI | InChI=1S/C11H22N4O/c1-7(2)15-11(10(12)9(4)13-15)14(5)8(3)6-16/h7-8,16H,6,12H2,1-5H3 |
| InChIKey | UZWMCLRAXGJQJL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |