C15H30N2O3 — CID 82960257
4-amino-N,N-bis(2-ethoxyethyl)cyclohexane-1-carboxamide (PubChem CID 82960257) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-amino-N,N-bis(2-ethoxyethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N,N-bis(2-ethoxyethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 82960257 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 4-amino-N,N-bis(2-ethoxyethyl)cyclohexane-1-carboxamide |
| SMILES | CCOCCN(CCOCC)C(=O)C1CCC(N)CC1 |
| InChI | InChI=1S/C15H30N2O3/c1-3-19-11-9-17(10-12-20-4-2)15(18)13-5-7-14(16)8-6-13/h13-14H,3-12,16H2,1-2H3 |
| InChIKey | UDCOZIJXJPCQNC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|