C16H15BrFNO — CID 82963206
N-[1-(5-bromo-2-fluorophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 82963206) has the molecular formula C16H15BrFNO and a molecular weight of 336.20 g/mol. Its IUPAC name is N-[1-(5-bromo-2-fluorophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | N-[1-(5-bromo-2-fluorophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 82963206 |
| Molecular Formula | C16H15BrFNO |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-[1-(5-bromo-2-fluorophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | CC(Nc1ccc2c(c1)CCO2)c1cc(Br)ccc1F |
| InChI | InChI=1S/C16H15BrFNO/c1-10(14-9-12(17)2-4-15(14)18)19-13-3-5-16-11(8-13)6-7-20-16/h2-5,8-10,19H,6-7H2,1H3 |
| InChIKey | IJFOKYCKGWTYLH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|