C16H14Cl3NO — CID 43788569
N-[1-(2,3,4-trichlorophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 43788569) has the molecular formula C16H14Cl3NO and a molecular weight of 342.65 g/mol. Its IUPAC name is N-[1-(2,3,4-trichlorophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | N-[1-(2,3,4-trichlorophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 43788569 |
| Molecular Formula | C16H14Cl3NO |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | N-[1-(2,3,4-trichlorophenyl)ethyl]-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | CC(Nc1ccc2c(c1)CCO2)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C16H14Cl3NO/c1-9(12-3-4-13(17)16(19)15(12)18)20-11-2-5-14-10(8-11)6-7-21-14/h2-5,8-9,20H,6-7H2,1H3 |
| InChIKey | GYUKIBVJQTVAEQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|