C16H15Cl2NO2 — CID 43096444
3,4-dichloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]aniline (PubChem CID 43096444) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is 3,4-dichloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]aniline.
| Compound Name | 3,4-dichloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]aniline |
|---|---|
| PubChem CID | 43096444 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 3,4-dichloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]aniline |
| SMILES | CC(Nc1ccc(Cl)c(Cl)c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H15Cl2NO2/c1-10(19-12-3-4-13(17)14(18)9-12)11-2-5-15-16(8-11)21-7-6-20-15/h2-5,8-10,19H,6-7H2,1H3 |
| InChIKey | CSCKTWXIKWRVOX-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |