C15H27N3O3 — CID 82963767
(2S)-2-amino-N-[2-[cyclopropyl(oxolan-3-ylmethyl)amino]-2-oxoethyl]-3-methylbutanamide (PubChem CID 82963767) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[cyclopropyl(oxolan-3-ylmethyl)amino]-2-oxoethyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[2-[cyclopropyl(oxolan-3-ylmethyl)amino]-2-oxoethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 82963767 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (2S)-2-amino-N-[2-[cyclopropyl(oxolan-3-ylmethyl)amino]-2-oxoethyl]-3-methylbutanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)N(CC1CCOC1)C1CC1 |
| InChI | InChI=1S/C15H27N3O3/c1-10(2)14(16)15(20)17-7-13(19)18(12-3-4-12)8-11-5-6-21-9-11/h10-12,14H,3-9,16H2,1-2H3,(H,17,20)/t11?,14-/m0/s1 |
| InChIKey | FQCLWEUYAZYAAL-IAXJKZSUSA-N |
| XLogP | 0.11 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |