C13H23N3O5 — CID 82964251
4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]-methylamino]oxolane-3-carboxylic acid (PubChem CID 82964251) has the molecular formula C13H23N3O5 and a molecular weight of 301.34 g/mol. Its IUPAC name is 4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]-methylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]-methylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 82964251 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 4-[[2-[[(2S)-2-amino-3-methylbutanoyl]amino]acetyl]-methylamino]oxolane-3-carboxylic acid |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)N(C)C1COCC1C(=O)O |
| InChI | InChI=1S/C13H23N3O5/c1-7(2)11(14)12(18)15-4-10(17)16(3)9-6-21-5-8(9)13(19)20/h7-9,11H,4-6,14H2,1-3H3,(H,15,18)(H,19,20)/t8?,9?,11-/m0/s1 |
| InChIKey | QRVORDUNXQHGJR-AMUVOQDHSA-N |
| XLogP | -1.36 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |