C12H26N2O2 — CID 82965328
[1-amino-3-[2-methoxyethyl(propan-2-yl)amino]cyclopentyl]methanol (PubChem CID 82965328) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is [1-amino-3-[2-methoxyethyl(propan-2-yl)amino]cyclopentyl]methanol.
| Compound Name | [1-amino-3-[2-methoxyethyl(propan-2-yl)amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 82965328 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | [1-amino-3-[2-methoxyethyl(propan-2-yl)amino]cyclopentyl]methanol |
| SMILES | COCCN(C(C)C)C1CCC(N)(CO)C1 |
| InChI | InChI=1S/C12H26N2O2/c1-10(2)14(6-7-16-3)11-4-5-12(13,8-11)9-15/h10-11,15H,4-9,13H2,1-3H3 |
| InChIKey | FCKGLEQIAYVSBU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |