C14H23N3O3 — CID 82965848
5-amino-N,N-bis(2-ethoxyethyl)pyridine-2-carboxamide (PubChem CID 82965848) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-amino-N,N-bis(2-ethoxyethyl)pyridine-2-carboxamide.
| Compound Name | 5-amino-N,N-bis(2-ethoxyethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 82965848 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 5-amino-N,N-bis(2-ethoxyethyl)pyridine-2-carboxamide |
| SMILES | CCOCCN(CCOCC)C(=O)c1ccc(N)cn1 |
| InChI | InChI=1S/C14H23N3O3/c1-3-19-9-7-17(8-10-20-4-2)14(18)13-6-5-12(15)11-16-13/h5-6,11H,3-4,7-10,15H2,1-2H3 |
| InChIKey | HOCKBHMVIUFUSO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|