C13H27NO2S — CID 82965927
[4-[[2-methoxyethyl(propan-2-yl)amino]methyl]oxan-4-yl]methanethiol (PubChem CID 82965927) has the molecular formula C13H27NO2S and a molecular weight of 261.43 g/mol. Its IUPAC name is [4-[[2-methoxyethyl(propan-2-yl)amino]methyl]oxan-4-yl]methanethiol.
| Compound Name | [4-[[2-methoxyethyl(propan-2-yl)amino]methyl]oxan-4-yl]methanethiol |
|---|---|
| PubChem CID | 82965927 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | [4-[[2-methoxyethyl(propan-2-yl)amino]methyl]oxan-4-yl]methanethiol |
| SMILES | COCCN(CC1(CS)CCOCC1)C(C)C |
| InChI | InChI=1S/C13H27NO2S/c1-12(2)14(6-9-15-3)10-13(11-17)4-7-16-8-5-13/h12,17H,4-11H2,1-3H3 |
| InChIKey | OORYGMKVEZFOGD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|