C12H25NOS2 — CID 112667555
[4-[[methyl(1-methylsulfanylpropan-2-yl)amino]methyl]oxan-4-yl]methanethiol (PubChem CID 112667555) has the molecular formula C12H25NOS2 and a molecular weight of 263.47 g/mol. Its IUPAC name is [4-[[methyl(1-methylsulfanylpropan-2-yl)amino]methyl]oxan-4-yl]methanethiol.
| Compound Name | [4-[[methyl(1-methylsulfanylpropan-2-yl)amino]methyl]oxan-4-yl]methanethiol |
|---|---|
| PubChem CID | 112667555 |
| Molecular Formula | C12H25NOS2 |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | [4-[[methyl(1-methylsulfanylpropan-2-yl)amino]methyl]oxan-4-yl]methanethiol |
| SMILES | CSCC(C)N(C)CC1(CS)CCOCC1 |
| InChI | InChI=1S/C12H25NOS2/c1-11(8-16-3)13(2)9-12(10-15)4-6-14-7-5-12/h11,15H,4-10H2,1-3H3 |
| InChIKey | YEVLAGOBOZPFJE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|