C15H30N2OS — CID 105418776
[4-[[[1-(dimethylamino)cyclobutyl]methyl-methylamino]methyl]oxan-4-yl]methanethiol (PubChem CID 105418776) has the molecular formula C15H30N2OS and a molecular weight of 286.49 g/mol. Its IUPAC name is [4-[[[1-(dimethylamino)cyclobutyl]methyl-methylamino]methyl]oxan-4-yl]methanethiol.
| Compound Name | [4-[[[1-(dimethylamino)cyclobutyl]methyl-methylamino]methyl]oxan-4-yl]methanethiol |
|---|---|
| PubChem CID | 105418776 |
| Molecular Formula | C15H30N2OS |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | [4-[[[1-(dimethylamino)cyclobutyl]methyl-methylamino]methyl]oxan-4-yl]methanethiol |
| SMILES | CN(CC1(CS)CCOCC1)CC1(N(C)C)CCC1 |
| InChI | InChI=1S/C15H30N2OS/c1-16(2)15(5-4-6-15)12-17(3)11-14(13-19)7-9-18-10-8-14/h19H,4-13H2,1-3H3 |
| InChIKey | KYYPGXGOWFESES-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|