C16H19BrN2O — CID 82968919
2-(1-aminoethyl)-5-bromo-N-cyclopropyl-N-(furan-2-ylmethyl)aniline (PubChem CID 82968919) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 2-(1-aminoethyl)-5-bromo-N-cyclopropyl-N-(furan-2-ylmethyl)aniline.
| Compound Name | 2-(1-aminoethyl)-5-bromo-N-cyclopropyl-N-(furan-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 82968919 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-(1-aminoethyl)-5-bromo-N-cyclopropyl-N-(furan-2-ylmethyl)aniline |
| SMILES | CC(N)c1ccc(Br)cc1N(Cc1ccco1)C1CC1 |
| InChI | InChI=1S/C16H19BrN2O/c1-11(18)15-7-4-12(17)9-16(15)19(13-5-6-13)10-14-3-2-8-20-14/h2-4,7-9,11,13H,5-6,10,18H2,1H3 |
| InChIKey | PZOYJXJHSMRJRM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |