C12H19BrN2O — CID 82971357
2-(1-aminoethyl)-4-bromo-N-(2-methoxyethyl)-N-methylaniline (PubChem CID 82971357) has the molecular formula C12H19BrN2O and a molecular weight of 287.20 g/mol. Its IUPAC name is 2-(1-aminoethyl)-4-bromo-N-(2-methoxyethyl)-N-methylaniline.
| Compound Name | 2-(1-aminoethyl)-4-bromo-N-(2-methoxyethyl)-N-methylaniline |
|---|---|
| PubChem CID | 82971357 |
| Molecular Formula | C12H19BrN2O |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-(1-aminoethyl)-4-bromo-N-(2-methoxyethyl)-N-methylaniline |
| SMILES | COCCN(C)c1ccc(Br)cc1C(C)N |
| InChI | InChI=1S/C12H19BrN2O/c1-9(14)11-8-10(13)4-5-12(11)15(2)6-7-16-3/h4-5,8-9H,6-7,14H2,1-3H3 |
| InChIKey | CLUUMFMSXNTJHK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |