C16H20BrN3 — CID 82971650
2-(1-aminoethyl)-4-bromo-N-methyl-N-(2-pyridin-4-ylethyl)aniline (PubChem CID 82971650) has the molecular formula C16H20BrN3 and a molecular weight of 334.26 g/mol. Its IUPAC name is 2-(1-aminoethyl)-4-bromo-N-methyl-N-(2-pyridin-4-ylethyl)aniline.
| Compound Name | 2-(1-aminoethyl)-4-bromo-N-methyl-N-(2-pyridin-4-ylethyl)aniline |
|---|---|
| PubChem CID | 82971650 |
| Molecular Formula | C16H20BrN3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 2-(1-aminoethyl)-4-bromo-N-methyl-N-(2-pyridin-4-ylethyl)aniline |
| SMILES | CC(N)c1cc(Br)ccc1N(C)CCc1ccncc1 |
| InChI | InChI=1S/C16H20BrN3/c1-12(18)15-11-14(17)3-4-16(15)20(2)10-7-13-5-8-19-9-6-13/h3-6,8-9,11-12H,7,10,18H2,1-2H3 |
| InChIKey | XQKVNIZYRAAMOC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |