C13H15BrFN3 — CID 82972817
N-[[3-(5-bromo-2-fluorophenyl)-1H-pyrazol-5-yl]methyl]propan-1-amine (PubChem CID 82972817) has the molecular formula C13H15BrFN3 and a molecular weight of 312.19 g/mol. Its IUPAC name is N-[[3-(5-bromo-2-fluorophenyl)-1H-pyrazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-(5-bromo-2-fluorophenyl)-1H-pyrazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82972817 |
| Molecular Formula | C13H15BrFN3 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-[[3-(5-bromo-2-fluorophenyl)-1H-pyrazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(-c2cc(Br)ccc2F)n[nH]1 |
| InChI | InChI=1S/C13H15BrFN3/c1-2-5-16-8-10-7-13(18-17-10)11-6-9(14)3-4-12(11)15/h3-4,6-7,16H,2,5,8H2,1H3,(H,17,18) |
| InChIKey | UDZPLTJVCPMKOD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|